C20H19N3O5S — CID 108509374
N'-(5-hydroxynaphthalen-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide (PubChem CID 108509374) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N'-(5-hydroxynaphthalen-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide.
| Compound Name | N'-(5-hydroxynaphthalen-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108509374 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N'-(5-hydroxynaphthalen-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C(=O)Nc2cccc3c(O)cccc23)cc1 |
| InChI | InChI=1S/C20H19N3O5S/c21-29(27,28)14-9-7-13(8-10-14)11-12-22-19(25)20(26)23-17-5-1-4-16-15(17)3-2-6-18(16)24/h1-10,24H,11-12H2,(H,22,25)(H,23,26)(H2,21,27,28) |
| InChIKey | VGLVKLZXIDZTNV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|