C17H17N5O4S — CID 108529242
N'-(3H-benzimidazol-5-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide (PubChem CID 108529242) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is N'-(3H-benzimidazol-5-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide.
| Compound Name | N'-(3H-benzimidazol-5-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108529242 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N'-(3H-benzimidazol-5-yl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C(=O)Nc2ccc3nc[nH]c3c2)cc1 |
| InChI | InChI=1S/C17H17N5O4S/c18-27(25,26)13-4-1-11(2-5-13)7-8-19-16(23)17(24)22-12-3-6-14-15(9-12)21-10-20-14/h1-6,9-10H,7-8H2,(H,19,23)(H,20,21)(H,22,24)(H2,18,25,26) |
| InChIKey | YRFGRDCZXBNHGX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|