C18H15N5O4S — CID 87745096
4-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzenesulfonamide (PubChem CID 87745096) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87745096 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 4-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2c(Nc3ccc4nc[nH]c4c3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C18H15N5O4S/c19-28(26,27)12-4-1-10(2-5-12)8-20-15-16(18(25)17(15)24)23-11-3-6-13-14(7-11)22-9-21-13/h1-7,9,20,23H,8H2,(H,21,22)(H2,19,26,27) |
| InChIKey | UKYKONQMQIADOZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|