C20H16N4O3 — CID 87746631
3-[(3-acetylphenyl)methylamino]-4-(3H-benzimidazol-5-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87746631) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-[(3-acetylphenyl)methylamino]-4-(3H-benzimidazol-5-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-acetylphenyl)methylamino]-4-(3H-benzimidazol-5-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87746631 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-[(3-acetylphenyl)methylamino]-4-(3H-benzimidazol-5-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(=O)c1cccc(CNc2c(Nc3ccc4nc[nH]c4c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C20H16N4O3/c1-11(25)13-4-2-3-12(7-13)9-21-17-18(20(27)19(17)26)24-14-5-6-15-16(8-14)23-10-22-15/h2-8,10,21,24H,9H2,1H3,(H,22,23) |
| InChIKey | SHQOMJLANJPMKH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|