C22H21N5O4 — CID 59807469
N-[2-[3-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]phenoxy]ethyl]acetamide (PubChem CID 59807469) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[2-[3-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2-[3-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 59807469 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[2-[3-[[[2-(3H-benzimidazol-5-ylamino)-3,4-dioxocyclobuten-1-yl]amino]methyl]phenoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1cccc(CNc2c(Nc3ccc4nc[nH]c4c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C22H21N5O4/c1-13(28)23-7-8-31-16-4-2-3-14(9-16)11-24-19-20(22(30)21(19)29)27-15-5-6-17-18(10-15)26-12-25-17/h2-6,9-10,12,24,27H,7-8,11H2,1H3,(H,23,28)(H,25,26) |
| InChIKey | ZMYPGIWPHPCBEM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|