C20H14N6O3 — CID 59807490
3-(3H-benzimidazol-5-ylamino)-4-[(3-oxo-4H-quinoxalin-6-yl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 59807490) has the molecular formula C20H14N6O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-ylamino)-4-[(3-oxo-4H-quinoxalin-6-yl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3H-benzimidazol-5-ylamino)-4-[(3-oxo-4H-quinoxalin-6-yl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59807490 |
| Molecular Formula | C20H14N6O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-(3H-benzimidazol-5-ylamino)-4-[(3-oxo-4H-quinoxalin-6-yl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1cnc2ccc(CNc3c(Nc4ccc5nc[nH]c5c4)c(=O)c3=O)cc2[nH]1 |
| InChI | InChI=1S/C20H14N6O3/c27-16-8-21-13-3-1-10(5-15(13)26-16)7-22-17-18(20(29)19(17)28)25-11-2-4-12-14(6-11)24-9-23-12/h1-6,8-9,22,25H,7H2,(H,23,24)(H,26,27) |
| InChIKey | DVQTUUMLQWOLLJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|