C30H21F2N5O2 — CID 152755136
2-[6-(3H-benzimidazol-5-ylmethylamino)-1H-benzimidazol-2-yl]-3-(3,5-difluorophenyl)-3-hydroxy-1-phenylprop-2-en-1-one (PubChem CID 152755136) has the molecular formula C30H21F2N5O2 and a molecular weight of 521.53 g/mol. Its IUPAC name is 2-[6-(3H-benzimidazol-5-ylmethylamino)-1H-benzimidazol-2-yl]-3-(3,5-difluorophenyl)-3-hydroxy-1-phenylprop-2-en-1-one.
| Compound Name | 2-[6-(3H-benzimidazol-5-ylmethylamino)-1H-benzimidazol-2-yl]-3-(3,5-difluorophenyl)-3-hydroxy-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 152755136 |
| Molecular Formula | C30H21F2N5O2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[6-(3H-benzimidazol-5-ylmethylamino)-1H-benzimidazol-2-yl]-3-(3,5-difluorophenyl)-3-hydroxy-1-phenylprop-2-en-1-one |
| SMILES | O=C(C(=C(O)c1cc(F)cc(F)c1)c1nc2ccc(NCc3ccc4nc[nH]c4c3)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C30H21F2N5O2/c31-20-11-19(12-21(32)13-20)29(39)27(28(38)18-4-2-1-3-5-18)30-36-24-9-7-22(14-26(24)37-30)33-15-17-6-8-23-25(10-17)35-16-34-23/h1-14,16,33,39H,15H2,(H,34,35)(H,36,37) |
| InChIKey | ICBRKVYRKDAMKC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|