C24H16F2N2O3 — CID 152746057
1-(3-acetylphenyl)-2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-en-1-one (PubChem CID 152746057) has the molecular formula C24H16F2N2O3 and a molecular weight of 418.40 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-en-1-one.
| Compound Name | 1-(3-acetylphenyl)-2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 152746057 |
| Molecular Formula | C24H16F2N2O3 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-(3-acetylphenyl)-2-(1H-benzimidazol-2-yl)-3-(3,5-difluorophenyl)-3-hydroxyprop-2-en-1-one |
| SMILES | CC(=O)c1cccc(C(=O)C(=C(O)c2cc(F)cc(F)c2)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C24H16F2N2O3/c1-13(29)14-5-4-6-15(9-14)22(30)21(23(31)16-10-17(25)12-18(26)11-16)24-27-19-7-2-3-8-20(19)28-24/h2-12,31H,1H3,(H,27,28) |
| InChIKey | BSCAFTGMRZKINQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|