C27H23FN2O6 — CID 135962008
(E)-2-(1H-benzimidazol-2-yl)-3-[3-[2-(1,2-dihydroxyethyl)-1,3-dioxolan-4-yl]phenyl]-1-(3-fluorophenyl)-3-hydroxyprop-2-en-1-one (PubChem CID 135962008) has the molecular formula C27H23FN2O6 and a molecular weight of 490.49 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[3-[2-(1,2-dihydroxyethyl)-1,3-dioxolan-4-yl]phenyl]-1-(3-fluorophenyl)-3-hydroxyprop-2-en-1-one.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-[2-(1,2-dihydroxyethyl)-1,3-dioxolan-4-yl]phenyl]-1-(3-fluorophenyl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 135962008 |
| Molecular Formula | C27H23FN2O6 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-[2-(1,2-dihydroxyethyl)-1,3-dioxolan-4-yl]phenyl]-1-(3-fluorophenyl)-3-hydroxyprop-2-en-1-one |
| SMILES | O=C(/C(=C(/O)c1cccc(C2COC(C(O)CO)O2)c1)c1nc2ccccc2[nH]1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H23FN2O6/c28-18-8-4-7-17(12-18)25(34)23(26-29-19-9-1-2-10-20(19)30-26)24(33)16-6-3-5-15(11-16)22-14-35-27(36-22)21(32)13-31/h1-12,21-22,27,31-33H,13-14H2,(H,29,30)/b24-23- |
| InChIKey | JTFIBQLLAYREHW-VHXPQNKSSA-N |
| XLogP | 3.78 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|