C29H20F2N4O2S — CID 152744628
1-[2-[1-(3,5-difluorophenyl)-1-hydroxy-3-oxo-3-phenylprop-1-en-2-yl]-3H-benzimidazol-5-yl]-3-phenylthiourea (PubChem CID 152744628) has the molecular formula C29H20F2N4O2S and a molecular weight of 526.57 g/mol. Its IUPAC name is 1-[2-[1-(3,5-difluorophenyl)-1-hydroxy-3-oxo-3-phenylprop-1-en-2-yl]-3H-benzimidazol-5-yl]-3-phenylthiourea.
| Compound Name | 1-[2-[1-(3,5-difluorophenyl)-1-hydroxy-3-oxo-3-phenylprop-1-en-2-yl]-3H-benzimidazol-5-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 152744628 |
| Molecular Formula | C29H20F2N4O2S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 1-[2-[1-(3,5-difluorophenyl)-1-hydroxy-3-oxo-3-phenylprop-1-en-2-yl]-3H-benzimidazol-5-yl]-3-phenylthiourea |
| SMILES | O=C(C(=C(O)c1cc(F)cc(F)c1)c1nc2ccc(NC(=S)Nc3ccccc3)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C29H20F2N4O2S/c30-19-13-18(14-20(31)15-19)27(37)25(26(36)17-7-3-1-4-8-17)28-34-23-12-11-22(16-24(23)35-28)33-29(38)32-21-9-5-2-6-10-21/h1-16,37H,(H,34,35)(H2,32,33,38) |
| InChIKey | ABBXFYWREDASIK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|