C25H18F4N4O5S — CID 135850874
(2R)-N'-[5-[(Z)-2-(1H-benzimidazol-2-yl)-1-hydroxy-3-oxo-3-(2,4,5-trifluorophenyl)prop-1-enyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide (PubChem CID 135850874) has the molecular formula C25H18F4N4O5S and a molecular weight of 562.50 g/mol. Its IUPAC name is (2R)-N'-[5-[(Z)-2-(1H-benzimidazol-2-yl)-1-hydroxy-3-oxo-3-(2,4,5-trifluorophenyl)prop-1-enyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide.
| Compound Name | (2R)-N'-[5-[(Z)-2-(1H-benzimidazol-2-yl)-1-hydroxy-3-oxo-3-(2,4,5-trifluorophenyl)prop-1-enyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide |
|---|---|
| PubChem CID | 135850874 |
| Molecular Formula | C25H18F4N4O5S |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (2R)-N'-[5-[(Z)-2-(1H-benzimidazol-2-yl)-1-hydroxy-3-oxo-3-(2,4,5-trifluorophenyl)prop-1-enyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide |
| SMILES | C[C@@H](O)/C(N)=N/S(=O)(=O)c1cc(/C(O)=C(/C(=O)c2cc(F)c(F)cc2F)c2nc3ccccc3[nH]2)ccc1F |
| InChI | InChI=1S/C25H18F4N4O5S/c1-11(34)24(30)33-39(37,38)20-8-12(6-7-14(20)26)22(35)21(25-31-18-4-2-3-5-19(18)32-25)23(36)13-9-16(28)17(29)10-15(13)27/h2-11,34-35H,1H3,(H2,30,33)(H,31,32)/b22-21+/t11-/m1/s1 |
| InChIKey | IESRHEMRUIJZDP-RCJUYNGUSA-N |
| XLogP | 3.86 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|