C17H11ClF2N2O3 — CID 136577543
methyl (Z)-2-(1H-benzimidazol-2-yl)-3-(2-chloro-4,5-difluorophenyl)-3-hydroxyprop-2-enoate (PubChem CID 136577543) has the molecular formula C17H11ClF2N2O3 and a molecular weight of 364.74 g/mol. Its IUPAC name is methyl (Z)-2-(1H-benzimidazol-2-yl)-3-(2-chloro-4,5-difluorophenyl)-3-hydroxyprop-2-enoate.
| Compound Name | methyl (Z)-2-(1H-benzimidazol-2-yl)-3-(2-chloro-4,5-difluorophenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 136577543 |
| Molecular Formula | C17H11ClF2N2O3 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl (Z)-2-(1H-benzimidazol-2-yl)-3-(2-chloro-4,5-difluorophenyl)-3-hydroxyprop-2-enoate |
| SMILES | COC(=O)/C(=C(\O)c1cc(F)c(F)cc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H11ClF2N2O3/c1-25-17(24)14(16-21-12-4-2-3-5-13(12)22-16)15(23)8-6-10(19)11(20)7-9(8)18/h2-7,23H,1H3,(H,21,22)/b15-14- |
| InChIKey | GIGVAUUFHIAETO-PFONDFGASA-N |
| XLogP | 4.09 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|