C18H14ClFN2O3S — CID 135883458
methyl (E)-2-(1H-benzimidazol-2-yl)-4-(3-chloro-4-fluorophenyl)sulfanyl-3-hydroxybut-2-enoate (PubChem CID 135883458) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-(3-chloro-4-fluorophenyl)sulfanyl-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-(3-chloro-4-fluorophenyl)sulfanyl-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135883458 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-(3-chloro-4-fluorophenyl)sulfanyl-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)CSc1ccc(F)c(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H14ClFN2O3S/c1-25-18(24)16(17-21-13-4-2-3-5-14(13)22-17)15(23)9-26-10-6-7-12(20)11(19)8-10/h2-8,23H,9H2,1H3,(H,21,22)/b16-15+ |
| InChIKey | CBWWHKZJUACFEV-FOCLMDBBSA-N |
| XLogP | 4.59 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|