C22H23N5O4S — CID 135584491
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135584491) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135584491 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(furan-2-yl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)CSc1nnc(-c2ccco2)n1CC(C)C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H23N5O4S/c1-13(2)11-27-20(17-9-6-10-31-17)25-26-22(27)32-12-16(28)18(21(29)30-3)19-23-14-7-4-5-8-15(14)24-19/h4-10,13,28H,11-12H2,1-3H3,(H,23,24)/b18-16+ |
| InChIKey | MMMKRGSKANEBSD-FBMGVBCBSA-N |
| XLogP | 4.30 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|