C27H22ClN5O4S — CID 135585123
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135585123) has the molecular formula C27H22ClN5O4S and a molecular weight of 548.02 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135585123 |
| Molecular Formula | C27H22ClN5O4S |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)CSc1nnc(-c2ccccc2OC)n1-c1ccc(Cl)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H22ClN5O4S/c1-36-22-10-6-3-7-18(22)25-31-32-27(33(25)17-13-11-16(28)12-14-17)38-15-21(34)23(26(35)37-2)24-29-19-8-4-5-9-20(19)30-24/h3-14,34H,15H2,1-2H3,(H,29,30)/b23-21+ |
| InChIKey | OPTUAIZDYOVXPZ-XTQSDGFTSA-N |
| XLogP | 5.71 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|