C22H20N6O3S — CID 135925907
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135925907) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135925907 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)CSc1nnc(-c2ccncc2)n1C1CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20N6O3S/c1-31-21(30)18(19-24-15-4-2-3-5-16(15)25-19)17(29)12-32-22-27-26-20(28(22)14-6-7-14)13-8-10-23-11-9-13/h2-5,8-11,14,29H,6-7,12H2,1H3,(H,24,25)/b18-17+ |
| InChIKey | ANWYOWXYEKHJAB-ISLYRVAYSA-N |
| XLogP | 3.79 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|