C21H20N6O3S — CID 135993427
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135993427) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135993427 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | CCn1c(SC/C(O)=C(\C(=O)OC)c2nc3ccccc3[nH]2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C21H20N6O3S/c1-3-27-19(13-8-10-22-11-9-13)25-26-21(27)31-12-16(28)17(20(29)30-2)18-23-14-6-4-5-7-15(14)24-18/h4-11,28H,3,12H2,1-2H3,(H,23,24)/b17-16+ |
| InChIKey | LZWQDMSLDGNVAL-WUKNDPDISA-N |
| XLogP | 3.47 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|