C17H17N5OS — CID 165437392
(NE)-N-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylethylidene]hydroxylamine (PubChem CID 165437392) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is (NE)-N-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 165437392 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (NE)-N-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-phenylethylidene]hydroxylamine |
| SMILES | CCn1c(SC/C(=N/O)c2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C17H17N5OS/c1-2-22-16(14-8-10-18-11-9-14)19-20-17(22)24-12-15(21-23)13-6-4-3-5-7-13/h3-11,23H,2,12H2,1H3/b21-15- |
| InChIKey | UCZBCNFCUCCCDS-QNGOZBTKSA-N |
| XLogP | 3.33 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|