C28H24N4O4S2 — CID 167974925
methyl (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylbut-2-enoate (PubChem CID 167974925) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is methyl (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylbut-2-enoate.
| Compound Name | methyl (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylbut-2-enoate |
|---|---|
| PubChem CID | 167974925 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | methyl (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylbut-2-enoate |
| SMILES | C=CCn1c(SC/C(O)=C(/C(=O)OC)c2nc3ccccc3[nH]2)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C28H24N4O4S2/c1-4-13-32-26(34)22-18(17-11-9-16(2)10-12-17)14-37-25(22)31-28(32)38-15-21(33)23(27(35)36-3)24-29-19-7-5-6-8-20(19)30-24/h4-12,14,33H,1,13,15H2,2-3H3,(H,29,30)/b23-21- |
| InChIKey | BDPWDUXSGGFAGF-LNVKXUELSA-N |
| XLogP | 5.73 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|