C25H20N4O2S2 — CID 4857436
N-(2-cyanophenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 4857436) has the molecular formula C25H20N4O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-cyanophenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4857436 |
| Molecular Formula | C25H20N4O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-(2-cyanophenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C#N)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C25H20N4O2S2/c1-3-12-29-24(31)22-19(17-10-8-16(2)9-11-17)14-32-23(22)28-25(29)33-15-21(30)27-20-7-5-4-6-18(20)13-26/h3-11,14H,1,12,15H2,2H3,(H,27,30) |
| InChIKey | IAJFHUNTOZDVSB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|