C19H18N2O3S2 — CID 4654849
methyl 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate (PubChem CID 4654849) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 4654849 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | methyl 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
| SMILES | C=CCn1c(SCC(=O)OC)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C19H18N2O3S2/c1-4-9-21-18(23)16-14(13-7-5-12(2)6-8-13)10-25-17(16)20-19(21)26-11-15(22)24-3/h4-8,10H,1,9,11H2,2-3H3 |
| InChIKey | OOWLXPMJPVCCDJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|