C26H25N3O2S2 — CID 40883902
N-(2-ethylphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 40883902) has the molecular formula C26H25N3O2S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-ethylphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 40883902 |
| Molecular Formula | C26H25N3O2S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-(2-ethylphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2CC)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C26H25N3O2S2/c1-4-14-29-25(31)23-20(19-12-10-17(3)11-13-19)15-32-24(23)28-26(29)33-16-22(30)27-21-9-7-6-8-18(21)5-2/h4,6-13,15H,1,5,14,16H2,2-3H3,(H,27,30) |
| InChIKey | KWNNNZZGIHKCIK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|