C23H18FN3O2S2 — CID 985293
N-(2-fluorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 985293) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-fluorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 985293 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-(2-fluorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2F)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C23H18FN3O2S2/c1-2-12-27-22(29)20-16(15-8-4-3-5-9-15)13-30-21(20)26-23(27)31-14-19(28)25-18-11-7-6-10-17(18)24/h2-11,13H,1,12,14H2,(H,25,28) |
| InChIKey | UIHQRMKHGGBYEO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|