C26H26N4O2S2 — CID 92543869
N-[[4-(dimethylamino)phenyl]methyl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 92543869) has the molecular formula C26H26N4O2S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 92543869 |
| Molecular Formula | C26H26N4O2S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccc(N(C)C)cc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C26H26N4O2S2/c1-4-14-30-25(32)23-21(19-8-6-5-7-9-19)16-33-24(23)28-26(30)34-17-22(31)27-15-18-10-12-20(13-11-18)29(2)3/h4-13,16H,1,14-15,17H2,2-3H3,(H,27,31) |
| InChIKey | WACQBJMSTHSPBI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|