C26H26N2OS2 — CID 40914169
2-[(4-tert-butylphenyl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 40914169) has the molecular formula C26H26N2OS2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40914169 |
| Molecular Formula | C26H26N2OS2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2ccc(C(C)(C)C)cc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C26H26N2OS2/c1-5-15-28-24(29)22-21(19-9-7-6-8-10-19)17-30-23(22)27-25(28)31-16-18-11-13-20(14-12-18)26(2,3)4/h5-14,17H,1,15-16H2,2-4H3 |
| InChIKey | JINXVVLVMSQQKV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|