C21H17N3OS2 — CID 41479953
5-phenyl-3-prop-2-enyl-2-(pyridin-2-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 41479953) has the molecular formula C21H17N3OS2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 5-phenyl-3-prop-2-enyl-2-(pyridin-2-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-phenyl-3-prop-2-enyl-2-(pyridin-2-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 41479953 |
| Molecular Formula | C21H17N3OS2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 5-phenyl-3-prop-2-enyl-2-(pyridin-2-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2ccccn2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H17N3OS2/c1-2-12-24-20(25)18-17(15-8-4-3-5-9-15)14-26-19(18)23-21(24)27-13-16-10-6-7-11-22-16/h2-11,14H,1,12-13H2 |
| InChIKey | WCTGWGSRLNDTIX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|