C23H25N3O3S2 — CID 42963782
2-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 42963782) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42963782 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)N2CC(C)OC(C)C2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C23H25N3O3S2/c1-4-10-26-22(28)20-18(17-8-6-5-7-9-17)13-30-21(20)24-23(26)31-14-19(27)25-11-15(2)29-16(3)12-25/h4-9,13,15-16H,1,10-12,14H2,2-3H3 |
| InChIKey | VTCBAULUPZBNDF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|