C25H29N3O2S2 — CID 16541462
N-cyclohexyl-N-ethyl-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 16541462) has the molecular formula C25H29N3O2S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-cyclohexyl-N-ethyl-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 16541462 |
| Molecular Formula | C25H29N3O2S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-cyclohexyl-N-ethyl-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(CC)C2CCCCC2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C25H29N3O2S2/c1-3-15-28-24(30)22-20(18-11-7-5-8-12-18)16-31-23(22)26-25(28)32-17-21(29)27(4-2)19-13-9-6-10-14-19/h3,5,7-8,11-12,16,19H,1,4,6,9-10,13-15,17H2,2H3 |
| InChIKey | ZNXWEHITPRAKMM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|