C21H21N3O4S3 — CID 40903371
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 40903371) has the molecular formula C21H21N3O4S3 and a molecular weight of 475.62 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40903371 |
| Molecular Formula | C21H21N3O4S3 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N[C@H]2CCS(=O)(=O)C2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H21N3O4S3/c1-2-9-24-20(26)18-16(14-6-4-3-5-7-14)11-29-19(18)23-21(24)30-12-17(25)22-15-8-10-31(27,28)13-15/h2-7,11,15H,1,8-10,12-13H2,(H,22,25)/t15-/m0/s1 |
| InChIKey | XZHDLVGGZFRHNL-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|