C17H20N4O3S2 — CID 6601373
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 6601373) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6601373 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)N[C@H]2CCS(=O)(=O)C2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C17H20N4O3S2/c1-2-9-21-16(13-6-4-3-5-7-13)19-20-17(21)25-11-15(22)18-14-8-10-26(23,24)12-14/h2-7,14H,1,8-12H2,(H,18,22)/t14-/m0/s1 |
| InChIKey | LUYWMZDERMIOJX-AWEZNQCLSA-N |
| XLogP | 1.53 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|