C26H29N5O2S — CID 2966835
N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]phenyl]benzamide (PubChem CID 2966835) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]phenyl]benzamide.
| Compound Name | N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 2966835 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]phenyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCCCC2)nnc1-c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N5O2S/c1-2-17-31-24(29-30-26(31)34-18-23(32)27-21-11-7-4-8-12-21)19-13-15-22(16-14-19)28-25(33)20-9-5-3-6-10-20/h2-3,5-6,9-10,13-16,21H,1,4,7-8,11-12,17-18H2,(H,27,32)(H,28,33) |
| InChIKey | SNXHHILMEBDLGR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|