C23H25N3O3S2 — CID 25442353
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[1-ethyl-5-(4-phenylphenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 25442353) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[1-ethyl-5-(4-phenylphenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[1-ethyl-5-(4-phenylphenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 25442353 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[1-ethyl-5-(4-phenylphenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | CCn1c(-c2ccc(-c3ccccc3)cc2)cnc1SCC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-2-26-21(19-10-8-18(9-11-19)17-6-4-3-5-7-17)14-24-23(26)30-15-22(27)25-20-12-13-31(28,29)16-20/h3-11,14,20H,2,12-13,15-16H2,1H3,(H,25,27)/t20-/m1/s1 |
| InChIKey | JBOMGXFIXDYMRM-HXUWFJFHSA-N |
| XLogP | 3.63 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|