C27H27N3O2S2 — CID 2450514
2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 2450514) has the molecular formula C27H27N3O2S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is 2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 2450514 |
| Molecular Formula | C27H27N3O2S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C=CCn1c(SCC(=O)N[C@H](C)CCc2ccccc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C27H27N3O2S2/c1-3-16-30-26(32)24-22(21-12-8-5-9-13-21)17-33-25(24)29-27(30)34-18-23(31)28-19(2)14-15-20-10-6-4-7-11-20/h3-13,17,19H,1,14-16,18H2,2H3,(H,28,31)/t19-/m1/s1 |
| InChIKey | MJKVLBXLJMULTQ-LJQANCHMSA-N |
| XLogP | 5.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|