C21H18N4O2S3 — CID 40914039
N-(4-methyl-1,3-thiazol-2-yl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 40914039) has the molecular formula C21H18N4O2S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40914039 |
| Molecular Formula | C21H18N4O2S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc(C)cs2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H18N4O2S3/c1-3-9-25-19(27)17-15(14-7-5-4-6-8-14)11-28-18(17)24-21(25)30-12-16(26)23-20-22-13(2)10-29-20/h3-8,10-11H,1,9,12H2,2H3,(H,22,23,26) |
| InChIKey | SYTMCMINCYZWQB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|