C25H22N4O3S2 — CID 3318905
N'-[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]benzohydrazide (PubChem CID 3318905) has the molecular formula C25H22N4O3S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N'-[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | N'-[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 3318905 |
| Molecular Formula | C25H22N4O3S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N'-[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]benzohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2ccccc2)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C25H22N4O3S2/c1-3-13-29-24(32)21-19(17-11-9-16(2)10-12-17)14-33-23(21)26-25(29)34-15-20(30)27-28-22(31)18-7-5-4-6-8-18/h3-12,14H,1,13,15H2,2H3,(H,27,30)(H,28,31) |
| InChIKey | ZCYBPKMHQXGDSO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|