C23H17BrN2O2S2 — CID 40914055
2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 40914055) has the molecular formula C23H17BrN2O2S2 and a molecular weight of 497.44 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40914055 |
| Molecular Formula | C23H17BrN2O2S2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2ccc(Br)cc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C23H17BrN2O2S2/c1-2-12-26-22(28)20-18(15-6-4-3-5-7-15)13-29-21(20)25-23(26)30-14-19(27)16-8-10-17(24)11-9-16/h2-11,13H,1,12,14H2 |
| InChIKey | DEFGRNZMUUFRRR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|