C23H17N5O2S2 — CID 2402197
2-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 2402197) has the molecular formula C23H17N5O2S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2402197 |
| Molecular Formula | C23H17N5O2S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCn2nnc3ccccc3c2=O)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C23H17N5O2S2/c1-2-12-27-22(30)19-17(15-8-4-3-5-9-15)13-31-20(19)24-23(27)32-14-28-21(29)16-10-6-7-11-18(16)25-26-28/h2-11,13H,1,12,14H2 |
| InChIKey | CPFRWXYJTPTSBF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|