C21H20N2O2S2 — CID 7870180
2-[(1R)-2-oxocyclohexyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7870180) has the molecular formula C21H20N2O2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[(1R)-2-oxocyclohexyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(1R)-2-oxocyclohexyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7870180 |
| Molecular Formula | C21H20N2O2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[(1R)-2-oxocyclohexyl]sulfanyl-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(S[C@@H]2CCCCC2=O)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C21H20N2O2S2/c1-2-12-23-20(25)18-15(14-8-4-3-5-9-14)13-26-19(18)22-21(23)27-17-11-7-6-10-16(17)24/h2-5,8-9,13,17H,1,6-7,10-12H2/t17-/m1/s1 |
| InChIKey | RDXRSEZGBZTXGL-QGZVFWFLSA-N |
| XLogP | 4.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|