C19H18N2O2S3 — CID 7484280
2-[(1R)-2-oxocyclohexyl]sulfanyl-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7484280) has the molecular formula C19H18N2O2S3 and a molecular weight of 402.57 g/mol. Its IUPAC name is 2-[(1R)-2-oxocyclohexyl]sulfanyl-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(1R)-2-oxocyclohexyl]sulfanyl-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7484280 |
| Molecular Formula | C19H18N2O2S3 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[(1R)-2-oxocyclohexyl]sulfanyl-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(S[C@@H]2CCCCC2=O)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C19H18N2O2S3/c1-2-9-21-18(23)16-12(14-8-5-10-24-14)11-25-17(16)20-19(21)26-15-7-4-3-6-13(15)22/h2,5,8,10-11,15H,1,3-4,6-7,9H2/t15-/m1/s1 |
| InChIKey | XBJANZUXYPQXDK-OAHLLOKOSA-N |
| XLogP | 4.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|