C21H16FN3O2S3 — CID 2239077
N-(4-fluorophenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 2239077) has the molecular formula C21H16FN3O2S3 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2239077 |
| Molecular Formula | C21H16FN3O2S3 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(F)cc2)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C21H16FN3O2S3/c1-2-9-25-20(27)18-15(16-4-3-10-28-16)11-29-19(18)24-21(25)30-12-17(26)23-14-7-5-13(22)6-8-14/h2-8,10-11H,1,9,12H2,(H,23,26) |
| InChIKey | QONWWOGCYIUSCV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|