C19H15N3OS3 — CID 25345034
3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 25345034) has the molecular formula C19H15N3OS3 and a molecular weight of 397.55 g/mol. Its IUPAC name is 3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 25345034 |
| Molecular Formula | C19H15N3OS3 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cccnc2)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C19H15N3OS3/c1-2-8-22-18(23)16-14(15-6-4-9-24-15)12-25-17(16)21-19(22)26-11-13-5-3-7-20-10-13/h2-7,9-10,12H,1,8,11H2 |
| InChIKey | BVFCWNZRBVOMQB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|