C16H13N3OS3 — CID 2591124
(2R)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanenitrile (PubChem CID 2591124) has the molecular formula C16H13N3OS3 and a molecular weight of 359.50 g/mol. Its IUPAC name is (2R)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanenitrile.
| Compound Name | (2R)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 2591124 |
| Molecular Formula | C16H13N3OS3 |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (2R)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanenitrile |
| SMILES | C=CCn1c(S[C@H](C)C#N)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C16H13N3OS3/c1-3-6-19-15(20)13-11(12-5-4-7-21-12)9-22-14(13)18-16(19)23-10(2)8-17/h3-5,7,9-10H,1,6H2,2H3/t10-/m1/s1 |
| InChIKey | FKMXDBLKQBXQMT-SNVBAGLBSA-N |
| XLogP | 4.38 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|