C24H23N3O2S3 — CID 16520105
N-(4-ethylphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 16520105) has the molecular formula C24H23N3O2S3 and a molecular weight of 481.67 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(4-ethylphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 16520105 |
| Molecular Formula | C24H23N3O2S3 |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-(4-ethylphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc(CC)cc2)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C24H23N3O2S3/c1-4-12-27-23(29)20-18(19-7-6-13-30-19)14-31-22(20)26-24(27)32-15(3)21(28)25-17-10-8-16(5-2)9-11-17/h4,6-11,13-15H,1,5,12H2,2-3H3,(H,25,28) |
| InChIKey | VYFJXRHVDDLXDL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|