C18H19N3O2S3 — CID 78734377
N,N-dimethyl-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 78734377) has the molecular formula C18H19N3O2S3 and a molecular weight of 405.57 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N,N-dimethyl-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 78734377 |
| Molecular Formula | C18H19N3O2S3 |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N,N-dimethyl-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)N(C)C)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C18H19N3O2S3/c1-5-8-21-17(23)14-12(13-7-6-9-24-13)10-25-15(14)19-18(21)26-11(2)16(22)20(3)4/h5-7,9-11H,1,8H2,2-4H3 |
| InChIKey | OJGWKWCVSZQXPP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|