C23H25N3O2S2 — CID 17466713
N-benzyl-2-(5-cyclopropyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropanamide (PubChem CID 17466713) has the molecular formula C23H25N3O2S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is N-benzyl-2-(5-cyclopropyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropanamide.
| Compound Name | N-benzyl-2-(5-cyclopropyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 17466713 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-benzyl-2-(5-cyclopropyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-methylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)N(C)Cc2ccccc2)nc2scc(C3CC3)c2c1=O |
| InChI | InChI=1S/C23H25N3O2S2/c1-4-12-26-22(28)19-18(17-10-11-17)14-29-20(19)24-23(26)30-15(2)21(27)25(3)13-16-8-6-5-7-9-16/h4-9,14-15,17H,1,10-13H2,2-3H3 |
| InChIKey | YKDCOIRVGOGKMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|