C22H24N4O2S — CID 96541991
(2R)-N,N-dibenzyl-2-[(5-oxo-4-prop-2-enyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 96541991) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is (2R)-N,N-dibenzyl-2-[(5-oxo-4-prop-2-enyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N,N-dibenzyl-2-[(5-oxo-4-prop-2-enyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 96541991 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (2R)-N,N-dibenzyl-2-[(5-oxo-4-prop-2-enyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C22H24N4O2S/c1-3-14-26-21(28)23-24-22(26)29-17(2)20(27)25(15-18-10-6-4-7-11-18)16-19-12-8-5-9-13-19/h3-13,17H,1,14-16H2,2H3,(H,23,28)/t17-/m1/s1 |
| InChIKey | RADDEVTUIDRCAN-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|