C24H29N3O2S — CID 42981563
N-benzyl-N-methyl-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 42981563) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-benzyl-N-methyl-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42981563 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-benzyl-N-methyl-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(C)CCn1c(SC(C)C(=O)N(C)Cc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H29N3O2S/c1-17(2)14-15-27-23(29)20-12-8-9-13-21(20)25-24(27)30-18(3)22(28)26(4)16-19-10-6-5-7-11-19/h5-13,17-18H,14-16H2,1-4H3 |
| InChIKey | SZNTYFLAOSYKKG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |