C23H27N3O3S — CID 7713139
(2S)-N-(2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 7713139) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2S)-N-(2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7713139 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2S)-N-(2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | COc1ccccc1NC(=O)[C@H](C)Sc1nc2ccccc2c(=O)n1CCC(C)C |
| InChI | InChI=1S/C23H27N3O3S/c1-15(2)13-14-26-22(28)17-9-5-6-10-18(17)25-23(26)30-16(3)21(27)24-19-11-7-8-12-20(19)29-4/h5-12,15-16H,13-14H2,1-4H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | SEDYVDAAFXYCMU-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |