C23H25ClN4O5S — CID 16959074
2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 16959074) has the molecular formula C23H25ClN4O5S and a molecular weight of 505.00 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 16959074 |
| Molecular Formula | C23H25ClN4O5S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 2-[7-chloro-3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Sc1nc2cc(Cl)ccc2c(=O)n1CCC(C)C |
| InChI | InChI=1S/C23H25ClN4O5S/c1-13(2)9-10-27-22(30)17-7-5-15(24)11-18(17)26-23(27)34-14(3)21(29)25-19-12-16(28(31)32)6-8-20(19)33-4/h5-8,11-14H,9-10H2,1-4H3,(H,25,29) |
| InChIKey | SRPKUKHYMBNNAD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|