C23H24N4O2S — CID 7713148
(2S)-N-(2-cyanophenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 7713148) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is (2S)-N-(2-cyanophenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(2-cyanophenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7713148 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2S)-N-(2-cyanophenyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(C)CCn1c(S[C@@H](C)C(=O)Nc2ccccc2C#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H24N4O2S/c1-15(2)12-13-27-22(29)18-9-5-7-11-20(18)26-23(27)30-16(3)21(28)25-19-10-6-4-8-17(19)14-24/h4-11,15-16H,12-13H2,1-3H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | OXYYNONTNSMKDI-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |